CHƯƠNG VII: THUẬT NGỮ Y HỌC TIẾNG ANH: HỆ TIẾT NIỆU-SINH DỤC | Y học online, giới thiệu sách Group cập nhật kiến thức y khoa CHƯƠNG VII: THUẬT NGỮ Y HỌC TIẾNG ANH: HỆ TIẾT NIỆU-SINH DỤC | Y học online, giới thiệu sách Group cập nhật kiến thức y khoa

Sổ tay người học tiếng anh y khoa

CHƯƠNG VII: THUẬT NGỮ Y HỌC TIẾNG ANH: HỆ TIẾT NIỆU-SINH DỤC



Khoa và bác sĩ chuyên khoa tiết niệu-sinh dục Các gốc từ thông dụng về hệ tiết niệu-sinh dục Các gốc từ thông dụng về hệ tiết niệu

Các gốc từ thông dụng về hệ sinh dục nữ Các gốc từ thông dụng về hệ sinh dục nam

Các hậu tố chỉ sự rối loạn và bệnh tật liên quan đến hệ tiết niệu-sinh dục

Thuật ngữ y học tiếng Anh: Hệ tiết niệu (1 gốc từ + 1 hậu tố chỉ sự rối loạn/bệnh tật)

Thuật ngữ y học tiếng Anh: Hệ tiết niệu (1 gốc từ + 1 gốc từ + 1 hậu tố chỉ sự rối loạn/bệnh tật)

Thuật ngữ y học tiếng Anh: Hệ sinh dục nữ (1 gốc từ + 1 hậu tố chỉ rối loạn/bệnh tật)

Thuật ngữ y học tiếng Anh: Hệ sinh dục nữ (1 gốc từ + 1 gốc từ + 1 hậu tố chỉ sự rối loạn/bệnh tật)

Thuật ngữ y học tiếng Anh: Hệ sinh dục nam (1 gốc từ + 1 hậu tố chỉ sự rối loạn/bệnh tật)

Thuật ngữ y học tiếng Anh: Hệ sinh dục nam (1 gốc từ + 1 gốc từ + 1 hậu tố chỉ sự rối loạn/bệnh tật)

Các hậu tố chỉ các phương thức phẫu thuật thông thường

Thuật ngữ y học tiếng Anh: Hệ tiết niệu-sinh dục (1 gốc từ + 1 hậu tố chỉ phương thức phẫu thuật)

Thuật ngữ y học tiếng Anh: Hệ tiết niệu-sinh dục (1 gốc từ + 1 gốc từ + 1 hậu tố chỉ phương thức phẫu thuật)

Các hậu tố tính từ

Thuật ngữ hệ tiết niệu-sinh dục: các hậu tố tính từ Các tính từ tiếng Anh y học: Hệ tiết niệu-sinh dục Các tính từ chỉ sự rối loạn/bệnh tật

Tiếng Anh y học với hậu tố -ic

Một số hậu tố và tiền tố liên quan đến hệ sinh dục nữ khác

Các tiền tố thường được dùng để xây dựng các thuật ngữ y học chỉ bệnh, sự rối loạn, và triệu chứng của hệ tiết niệu

Các tiền tố chỉ số lượng Các tiền tố chỉ màu sắc Các tiền tố chỉ thời gian

Các bệnh thông thường liên quan đến hệ sinh dục nữ Các bệnh thông thường liên quan đến hệ sinh dục nam Các bệnh lây qua đường tình dục

Các triệu chứng tiết niệu thông thường Dụng cụ y tế và thiết bị

Các dụng cụ liên quan đến hệ tiết niệu-sinh dục và một số dụng cụ với hậu tố “-scope” và “-meter”

Sự khám bệnh và chẩn đoán bằng công cụ “-gram” (bản ghi, hình ảnh), “-graph” (dụng cụ dùng để ghi), “-graphy” (phép ghi, kỹ thuật dùng để ghi)

Các thuật ngữ về hệ sinh sản nữ và sản khoa

Mục lục

Khoa và bác sĩ chuyên khoa tiết niệu-sinh dục

Urology: nghiên cứu niệu khoa Department of Urology: Khoa tiết niệu Urologist: bác sĩ tiết niệu

Department of nephro-urology: Khoa niệu-thận

Gyna(e)cology: nghiên cứu phụ khoa Department of Gyn(a)ecology: Khoa phụ khoa Gyn(a)ecologist: bác sĩ phụ khoa

Urogyn(a)ecologist: bác sĩ chuyên ngành phụ-niệu Obstetrics: sản khoa

Department of Obstetrics & Gyn(a)ecology: Khoa phụ-sản

Obstetrician: bác sĩ sản khoa Consulting room: phòng khám Waiting room: phòng chờ.

Delivery room: phòng đẻ Labour ward: khu phụ sản Nursery: phòng trẻ sơ sinh

Consultant in obstetrics: bác sĩ tư vấn về sản khoa.

Hậu tố –logy kết hợp với gốc từ ur(o) thành “urology”: niệu khoa; với gốc từ gyn(a)ec(o) thành “gyn(a)ecology”: phụ khoa; hậu tố -ics kết hợp với gốc từ obstetr(i) thành “obstetrics”: sản khoa.

Hậu tố -ian kết hợp với obstetric thành “obstetrician”: bác sĩ sản khoa; hậu tố –(o)logist kết hợp với ur(o) thành “urologist”: bác sĩ niệu khoa.

Xin xem các ví dụ:

Uro + logy = urology: niệu khoa

Gyn(a)eco + logy = gyn(a)ecology: sản khoa Obstetr(i) + ics = obstetrics: phụ khoa

Uro + logist = urologist: bác sĩ niệu khoa

Gyn(a)eco + logist = gyn(a)ecologist: bác sĩ sản khoa Obstetric + ian = obstetrician: bác sĩ phụ khoa

Các gốc từ (roots) thông dụng về Hệ Tiết niệu-Sinh dục Các gốc từ thông dụng về Hệ Tiết niệu

Gốc từ        Nghĩa          Từ Việt tương đương    Ví dụ

  1. Nephr(o) [Gr]*: Kidney   thận. Nephrectomy (th/th cắt bỏ thận)
  2. Ren(o) [L]*: Kidney thận. Renopathy (bệnh thận)
  3. Cyst(o) [Gr]: Bladder bàng quang. Cystectomy (th/th cắt bỏ bàng quang)
  4. Vesic(o) [L]: Bladder  bàng quang. Vesicotomy (th/th mở bàng quang)
  5. Pyel(o): Renal pelvis bể thận. Pyelitis (viêm bể thận)
  6. Ureter(o): Ureter niệu quản. Ureteroplasty (th/th tạo hình niệu quản)
  7. Urethr(o): Urethra niệu đạo. Urethrotomy (th/th mở niệu đạo)
  8. Ur(o)/urin(o): Urine nước tiểu. Urolith (niệu sỏi)
  9. Gr: viết tắt của từ Greek, chỉ gốc từ Hy lạp
  10. L: viết tắt của từ Latin, chỉ gốc từ Latin

Các gốc từ thông dụng về Hệ Sinh dục nữ

Gốc từ        Nghĩa      Từ tương đương tiếng Việt   Ví dụ

  1. Salping(o): Uterine/Fallopian tube   vòi tử cung, vòi trứng. Salpingitis (viêm vòi tử cung)
  2. Oophor(o) [Gr]: Ovary buồng trứng. Oophorectomy (th/th cắt bỏ buồng trứng)
  3. Ovari(o) [L]: Ovary buồng trứng. Ovarian (thuộc về buồng trứng)
  4. Metr(o) [L]: Womb tử cung. Metritis (viêm tử cung)
  5. Hyster(o) [Gr]: Womb tử cung. Hysteropathy (bệnh tử cung)
  6. Colp(o) [Gr]: Vagina âm đạo. Colpitis (viêm âm đạo)
  7. Vagin(o) [L]: Vagina âm đạo. Vaginopexy (th/th cố định âm đạo)
  8. Vulv(o) : Vulva âm hộ. Vulvectomy (th/th cắt bỏ âm hộ)
  9. Amni(o): Amnion màng ối Amniocentesis (chọc dò màng ối qua bụng)
  10. Cervic(o): Cervix, neck cổ tử cung Cervicitis (viêm cổ tử cung)
  11. Chori(o)/chorion(o): Chorion   màng đệm Chorionic (thuộc về màng đệm)
  12. Men(o): Menses, menstruation kinh nguyệt Menorrhagia (chứng rong kinh)
  13. Mamm(o): Breasts vú Mammography (chụp X-quang tuyến vú)

Các gốc từ thông dụng về Hệ Sinh dục nam

Gốc từ       Nghĩa      Từ tương đương tiếng Việt   Ví dụ

  1. Andr(o): Man đàn ông. Andrology (nam khoa)
  2. Balan(o): Glans penis quy đầu. Balanitis (viêm quy đầu)
  3. Epididym(o): Epididymis mào tinh hoàn. Epididymitis (viêm mào tinh hoàn)
  4. Test(o): Testis tinh hoàn. Testectomy (th/th cắt bỏ tinh hoàn)
  5. Prostat(o): Prostate gland   tuyến tiền liệt.   Prostatolith (sỏi tuyến tiền liệt)
  6. Phall(o): Penis dương vật. Phalloplasty (th/th tạo hình dương vật)
  7. Vas(o): Vas deferens   ống dẫn tinh.   Vasectomy (th/th cắt bỏ ống dẫn tinh)
  8. Orch(o)/orchi(o)/orchid(o): Testis tinh hoàn. Orchectomy (cắt bỏ tinh hoàn); orchiectomy (cắt bỏ tinh hoàn), orchidoplasty (tạo hình tinh hoàn)
  9. Vesicul(o): Seminal vesticles túi tinh dịch.
  10. Sperm(o)/spermat(o): Sperm   tinh trùng.   Spermatology (tinh trùng học)
  11. Scrot: Scrotum bìu Scrotectomy (th/th cắt bìu) Lưu ý:
  12. Vas(o): là một gốc từ có 2 nghĩa (1. chỉ mạch/mạch máu. 2. ống dẫn tinh)
  13. chỉ mạch/mạch máu (vasography: Chụp X-quang mạch, vasospam: co mạch …)
  14. ống dẫn tinh (vasitis: viêm ống dẫn tinh, vasopuncture: chọc ống dẫn tinh, vasorrhaphy: th/th khâu ống dẫn tinh, vasostomy: th/th mở thông ống dẫn tinh, vasotomy: th/th rạch ống dẫn tinh …)

Các hậu tố chỉ sự rối loạn và bệnh tật liên quan đến Hệ Tiết niệu- Sinh dục

  1. -Itis: Inflammation viêm. Oophoritis: viêm buồng trứng
  2. Asis; -esis; -iasis; -osis: “Condition/presence of” chỉ một tình trạng bất thường, là dấu hiệu hay triệu chứng của bệnh. Enuresis: chứng đái dầm: nephrolithiasis: bệnh sỏi thận; hydronephrosis: bệnh thận ứ nước.
  3. -Alg(ia): Pain/ache đau, sự khó chịu. Hysteralgia: (chứng) đau tử cung.
  4. Odyn(ia): Pain/ache đau, sự khó chịu. Colpodynia: (chứng) đau âm đạo.
  5. -Oma: Tumor u, bướu. Oophoroma: u buồng trứng.
  6. -Cele: Hernia thoát vị, lồi. Cystocele: thoát vị bàng quang.
  7. -Pathy: Disease bệnh. Renopathy: bệnh thận.
  8. -Phobia: Fear sợ. Urophobia: chứng sợ phải đi tiểu tiện.
  9. -Rrhoea: Discharge chảy, tiết dịch. Menorrhoea: kinh nguyệt.
  10. -Rrhagia: Bleeding chảy máu, xuất huyết. Ureterorrhagia: xuất huyết niệu quản.

Thuật ngữ y học tiếng Anh: Hệ tiết niệu (1 gốc từ + 1 hậu tố chỉ sự rối loạn/bệnh tật)

  1. Nephr(o): nephritis (chứng viêm thận); nephralgia (chứng đau thận); nephroma (u thận); nephropathy (bệnh thận); nephrorrhagia (xuất huyết thận); nephrocele (thoát vị thận).
  2. Cyst(o): cystitis (viêm bàng quang); cystodynia (đau bàng quang); cystocele (thoát vị bàng quang); cystoplegia (liệt bàng quang).
  3. Ureter(o): ureteritis (viêm niệu quản); ureteralgia (đau niệu quản); ureteropathy (bệnh niệu quản); urterorrhagia (xuất huyết niệu quản); ureterocele (u niệu quản).
  4. Urethr(o): urethritis (viêm niệu đạo); urethralgia (đau niệu đạo); urethrodynia (đau niệu đạo); urethrocele (sa niệu đạo); urethrorrhagia (xuất huyết niệu đạo); urethrorrhea (tiết dịch niệu đạo).
  5. Ur(o): urocele (nang niệu); uropathy (bệnh đường niệu), urorrhagia (đa niệu); urorrhea (chứng đái dầm).

Thuật ngữ y học tiếng Anh: Hệ tiết niệu (1 gốc từ + 1 gốc từ + 1 hậu tố chỉ sự rối loạn/bệnh tật)

Trong phần trên là các thuật ngữ gồm 1 gốc từ + 1 hậu tố. Tuy nhiên ta cũng bắt gặp các thuật ngữ gồm 1 gốc từ + 1 gốc từ + 1 hậu tố như         từ   “genito-urinary”   gồm   gốc   từ   “genit(o)”   (sinh   dục)   +   gốc từ  “urin(o)”  (nước  tiểu)  +  hậu  tố  dùng  để  cấu   thành   tính   từ “ary” thành “genio-urinary”: thuộc về tiết niệu-sinh dục. Sau đây là các thuật ngữ Hệ tiết niệu có cấu trúc gồm 2 gốc từ + một hậu tố.

Thuật ngữ y học tiếng Anh: Hệ sinh dục nữ (1 gốc từ + 1 hậu tố chỉ sự rối loạn/bệnh tật)

  1. Salping(o): salpingitis (viêm vòi trứng); salpingocele (thoát vị vòi tử cung); salpingorrhagia (xuất huyết vòi tử cung).
  2. Oophor(o): oophoritis (viêm buồng trứng); oophoralgia (đau buồng trứng); oophoroma (u buồng trứng); oophoropathy (bệnh ở buồng trứng); oophorrhagia (xuất huyết buồng trứng).
  3. Ovari(o): ovaritis (viêm buồng trứng); ovarialgia (đau buồng trứng); ovariocele (thoát vị buồng trứng); ovariopathy (bệnh buồng trứng).
  4. Metr(o): metritis (viêm tử cung); metrocele (thoát vị tử cung); metrodynia ([chứng] đau tử cung); metropathy (bệnh tử cung); metrorrhagia (băng huyết); metrorrhea (khí hư).
  5. Hyster(o): hysteritis (viêm tử cung); hysteralgia (đau tử cung); hysterocele (thoát vị tử cung); hysterodynia (đau tử cung); hysteropathy (bệnh tử cung).
  6. Colp(o): colpitis (viêm âm đạo); colpocele (thoát vị âm đạo); colpalgia (đau âm đạo); colpodynia (đau âm đạo); colporrhagia (chảy máu âm đạo).
  7. Vagin(o): vaginitis (viêm âm đạo); vaginocele (thoát vị âm đạo); vaginodynia (đau âm đạo); vaginopathy (bệnh âm đạo).
  8. Vulv(o): vulvitis (viêm âm hộ); vulvopathy (bệnh âm hộ); vulvodynia ([chứng] đau âm hộ).
  9. Amni(o): amnitis (viêm màng ối); amnionitis (viêm màng ối).
  10. Mamm(o): mammitis (viêm vú); mammalgia (đau vú).

Thuật ngữ y học tiếng Anh: Hệ sinh dục nữ (1 gốc từ + 1 gốc từ + 1 hậu tố chỉ sự rối loạn/bệnh tật)

Thuật ngữ y học tiếng Anh: Hệ sinh dục nam (1 gốc từ + 1 hậu tố chỉ sự rối loạn/bệnh tật)

  1. Andr(o): andropathy (bệnh nam khoa); androphobia (bệnh sợ hãi nam giới).
  2. Balan(o): balanitis (viêm quy đầu); balanocele (thoát vị quy đầu); balanorrhagia (viêm quy đầu xuất huyết); balanorrhea (viêm quy đầu chảy mủ).
  3. Vas(o): vasitis (viêm ống dẫn tinh).
  4. Orchid(o)/orchi(o): orchiditis (viêm tinh hoàn); orchialgia (đau tinh hoàn); orchiodynia (đau tinh hoàn); orchiocele (sa bìu dái); orchiopathy (bệnh ở tinh hoàn).
  5. Phall(o):  phallitis  (viêm  dương  vật);  phallalgia  (đau  dương      vật); phallodynia (đau dương vật); phallorrhagia (xuất huyết dương vật).
  6. Prostat(o): prostatalgia (đau tuyến tiền liệt); prostatitis (viêm tuyến tuyền liệt); prostatodynia (đau tuyến tiền liệt); prostatosis (bệnh tuyến tiền liệt), prostatorrhea (xuất tiết tuyến tiền liệt).

Thuật ngữ y học tiếng Anh: Hệ sinh dục nam (1 gốc từ + 1 gốc từ

+ 1 hậu tố chỉ sự rối loạn/bệnh tật) Vasovesiculitis: viêm túi tinh-viêm ống dẫn tinh Prostatocystitis: viêm tuyến tiền liệt-bàng quang

Các hậu tố chỉ các phương thức phẫu thuật thông thường

  1. -Tomy: Cut/incise rạch, mở, cắt. Pyelotomy (th/th mở bể thận)
  2. -Ectomy: Cut out/remove  cắt bỏ, lấy đi. Hysterectomy (th/th cắt bỏ tử cung)
  3. -Stomy:   Provide   with   an   opening/mouth   mở   thông,   dẫn      lưu. Cystostomy (th/th mở thông bàng quang)
  4. -Pexy: Fix cố định. Nephropexy (th/th cố định thận)
  5. -Rrhaphy: Suture khâu. Salpingorrhaphy (th/th khâu vòi tử cung)
  6. -Centesis: Puncture chọc, dò. Ovariocentesis (chọc dò buồng trứng)
  7. Plasty: Shape phẫu thuật tạo hình, chỉnh hình. Pyeloplasty (tạo hình bể thận)

Thuật ngữ y học tiếng Anh: Hệ tiết niệu-sinh dục (1 gốc từ + 1 hậu tố chỉ phương thức phẫu thuật)

  1. Nephr(o): nephrotomy (th/th mở thận); nephroectomy (cắt bỏ thận); nephrostomy (mở thông thận); nephropexy (cố định thận); nephrorrhaphy (khâu thận).
  2. Cyst(o): cystotomy (th/th mở/rạch bàng quang); cystectomy (cắt bỏ bàng quang); cystostomy (mở bàng quang);cystopexy (cố định bàng quang); cystorrhaphy (khâu bàng quang); cystoplasty (tạo hình bàng quang).
  3. Vesic(o): vesicotomy (th/th rạch bàng quang); vesicostomy (mở bàng quang).
  4. Ureter(o): ureterotomy (th/th rạch niệu quản); ureterectomy (cắt bỏ niệu quản); ureterostomy (th/th mở thông niệu quản); ureterorrhaphy (khâu niệu quản), ureteroplasty (tạo hình niệu quản).
  5. Urethr(o): urethrotomy (th/th rạch thông niệu đạo); urethrectomy (cắt bỏ niệu đạo); urethrostomy (mở thông niệu đạo); urethropexy (cố định niệu đạo); urethrorrhaphy (khâu niệu đạo), urethroplasty (tạo hình niệu đạo).
  6. Hyster(o): hysterotomy (th/th mở tử cung); hysterectomy (cắt bỏ tử cung); hysteropexy (cố định tử cung); hysterorrhaphy (khâu tử cung).
  7. Mamm(o): mammotomy (giải phẫu vú); mammectomy (cắt bỏ vú); mammoplasty (tạo hình vú).

Thuật ngữ y học tiếng Anh: Hệ tiết niệu-sinh dục (1 gốc từ + 1 gốc từ + 1 hậu tố chỉ phương thức phẫu thuật)

Các hậu tố tính từ

Thuật ngữ hệ tiết niệu-sinh dục: các hậu tố tính từ

Một số hậu tố có chức năng tính từ như: –ac; -al; -ar; -ary; -an; – ic; -ical;

-ile; -ous… khi kết hợp với những gốc từ Hệ sinh dục-tiết niệu sẽ cho ta những tính từ.

Các tính từ tiếng Anh y học: hệ tiết niệu-sinh dục

Các tính từ chỉ sự rối loạn/bệnh tật trong tiếng Anh y học với hậu tố – IC

-IC là hậu tố phổ biến và thường được tìm thấy ở các tính từ mà tương ứng với các danh từ tận cùng bằng các hậu tố chỉ sự rối loạn/bệnh tật như sau:

  1. Itis / itic; 2. Pathy / pathic; 3. Plegia / plegic; 4. Rrhea / rrheic; 5. Rrhagia

/ rrhagic; 6. Scope / scopic; 7. Sclerosis / sclerotic; 8. Statis / static; 9. Trophy / trophic.

Ví dụ, danh từ “amenorrhea” (mất kinh) thành tính từ “amenorrheic”.

Một số hậu tố và tiền tố liên quan đến hệ sinh dục nữ khác Hậu tố:

  1. -Arche: Beginning bắt đầu Menarche (lần hành kinh đầu)
  2. -Cyesis: Pregnancy thai nghén Pseudocyesis (thai nghén giả)
  3. -Gravida: Pregnant có thai Primigravida (người có thai lần đầu)
  4. -Parous: Bearing có thai Primiparous (có thai lần đầu)
  5. -Salpinx: Fallopian tube vòi trứng Pyosalpinx (chứng tích mủ ở buồng trứng)
  6. -Tocia: Labo(u)r/birth sinh/đẻ Dystocia (sinh khó)

Tiền tố:

  1. Primi: First đầu tiên Primipara (1. người có thai lần đầu)
  2. Retro: Backward vị trí đằng sau Retroversion (ngã ra sau)

Các tiền tố thường được dùng để xây dựng các TNYH chỉ bệnh, rối loạn, và triệu chứng của hệ tiết niệu:

Các tiền tố chỉ số lượng

Các tiền tố chỉ màu sắc

Các tiền tố chỉ thời gian

Một số tiền tố khác như:

Các bệnh thông thường liên quan đến hệ tiết niệu-sinh dục Các bệnh thông thường liên quan đến hệ tiết niệu-sinh dục nữ:

  1. Amenorrhea: mất kinh.
  2. Dysmenorrhea: chứng đau kinh.
  3. Menorrhagia: chứng đa kinh/rong kinh.
  4. Metrorrhagia: băng huyết.
  5. Oligmenorrhea: chứng ít kinh nguyệt.
  6. Cervical stenosis: hẹp tử cung. đn. metrostenosis.
  7. Cervical incompetence: bất túc cổ tử cung (tử cung không đậu thai).
  8. Vaginitis: viêm âm đạo.
  9. Vaginal prolapse: sa âm đạo.
  10. Vulvodynia: đau âm hộ.
  11. Vaginismus: chứng co rút, đau âm đạo.
  12. Ectopic pregnancy: thai lạc chổ
  13. Polycystic ovarian disease: bệnh buồng trứng đa năng.
  14. Endometriosis: bệnh lạc nội mạc tử cung.

Các bệnh thông thường liên quan đến hệ tiết niệu-sinh dục nam:

  1. Benign prostatic hyperplasia: tăng sản lành tính tuyến tiền liệt.
  2. Interstitial cystitis: viêm bàng quang kẽ.
  3. Kidney stone: sỏi thận.
  4. Penile cancer: ung thư dương vật.
  5. Priapism: chứng cương đau dương vật.
  6. Prostatitis: viêm tuyến tiền liệt.
  7. Proteinuria: protein niệu.
  8. Renal failure: suy thận.
  9. Urinary tract infection: nhiễm trùng đường niệu.
  10. Urinary incontinence: đái dầm. đn. enuresis.
  11. Urinary retention: bí tiểu.

Các bệnh lây qua đường tình dục:

  1. Chlamydia: chlamydia, hạ cam mềm.
  2. Genital herpes: bệnh mụn giộp sinh dục.
  3. Gonorrhea: bệnh lậu.
  4. HIV/AIDS: bệnh liệt kháng.
  5. STDs: bệnh truyền qua đường tình dục.
  6. Pelvic inflammatory disease: bệnh viêm vùng chậu.
  7. Genital warts: mụn cóc sinh dục.

Các triệu chứng tiết niệu thông thường

Frequency: tiểu nhiều lần, tiểu dắt Urgency: tiểu gấp, mắc tiểu Dribbling: tiểu lắt nhắt, đái nhỏ giọt Hesitancy: không tiểu được Dysuria: tiểu đau, tiểu buốt Oliguria: tiểu ít

Polyuria: tiểu nhiều, đa niệu Nocturia: tiểu đêm

Ha(e)maturia: tiểu máu, huyết niệu Pyuria: tiểu mủ

Retention of urine / urinary retention: bí tiểu Incontinence of urine / urinary incontinence: đái dầm

Dụng cụ và thiết bị y tế

  1. Scissors: cái kéo.
  2. Forceps: kìm/cái cặp thai.
  3. Examination light: đèn khám.
  4. Scalpel: dao mổ.
  5. Weighing scales: cái cân.
  6. Syringe: ống tiêm.
  7. Stethoscope: ống nghe.
  8. Thermometer: nhiệt kế, cái cặp nhiệt.
  9. Cotton wool: bông (băng).
  10. Tourniquet: garô.
  11. Adhesive tape: băng dính.
  12. Needle: kim tiêm.
  13. Examination couch: giường khám.
  14. Sphygmomanometer: cái đo mạch.
  15. Tongue depressor (tiếng Mỹ): cái đè lưỡi. đn. spatula (tiếng Anh).
  16. Sterile latex gloves: găng cao su khử trùng.
  17. Needle holder: kéo cặp kim (tiêm).
  18. Tendon hammer: búa phản xạ. đn. tendon hammer, percussor.
  19. Incubator: lồng kính nuôi trẻ.
  20. Dilator: que nong.
  21. Curette: que nạo.

Các dụng cụ liên quan đến hệ tiết niệu-sinh dục và một số dụng cụ với hậu tố “scope” và “meter”

  1. Urethroscope: dụng cụ soi niệu đạo.
  2. Vaginoscope: dụng cụ khám âm đạo, mỏ vịt. đn: vaginal speculum.
  3. Colposcope: dụng cụ khám âm đạo. đn: vaginal speculum.
  4. Urethrometer: niệu đạo kế.
  5. Vaginometer: thước đo âm đạo.
  6. Vaginotome: dụng cụ phẫu thuật âm đạo.
  7. Catheter: cái thông nước tiểu.
  8. Urinometer: niệu kế.

Sự khám bệnh và chẩn đoán bằng công cụ -gram (bản ghi, hình ảnh), -graph (dụng cụ dùng để ghi), -graphy (phép ghi, kỹ thuật dùng để ghi)

  1. Nephrogram/renogram: phim X-quang chụp thận/thận đồ.
  2. Nephrography/renograph: chụp X-quang thận.
  3. Cystogram: phim X-quang bàng quang.
  4. Cystography: chụp X-quang bàng quang.
  5. Hysterogram: phim chụp X-quang tử cung.
  6. Hysterography: chụp X-quang tử cung.
  7. Salpingography: chụp X-quang vòi tử cung.

Các xét nghiệm và phương thức phẫu thuật liên quan đến hệ sinh dục/hệ sinh sản nữ

  1. Pap test: xét nghiệm Pap
  2. Pregnancy test: xét nghiệm (mang) thai
  3. Hysterosalpingography (HSG): chụp X-quang tử cung vòi
  4. Mammography: chụp X-quang tuyến vú
  5. Breast ultrasound imaging: kỹ thuật hình ảnh siêu âm tuyến vú
  6. Breast MRI: chụp cộng hưởng từ tuyến vú
  7. Pelvic ultrasonography: chụp siêu âm khung chậu
  8. Aspiration: sự hút
  9. Cauterization: đốt
  10. Conization: th/th cắt bỏ nón mô, cắt bỏ phần cổ tử cung
  11. Cryosurgery: phẫu thuật lạnh
  12. Culdocentesis: chọc hút túi cùng
  13. Dila(ta)tion and curettage (D&C): nông và nạo
  14. Laparoscopy: phép soi ổ bụng
  15. Pelvimitry: phương pháp đo chậu hông

Một số từ viết tắt y khoa (abbreviations) liên quan đến Hệ tiết niệu-sinh dục:

  1. CSU (catheter specimen of urine): mẫu nước tiểu qua ống thông.
  2. GUS (genito-uirary system): hệ tiết niệu-sinh dục.
  3. IVP (intravenous pyelogram): chụp bể thận qua đường tĩnh mạch.
  4. IVU (intravenous urogram): chụp niệu qua đường tĩnh mạch.
  5. KUB (kidney, ureter and bladder): thận, niệu quản và bàng quang.
  6. MUS (midstream urine): nước tiểu giữa dòng.
  7. MSSU (midsream specimen of urine): mẫu nước tiểu giữa dòng.
  8. NPU (not passed urine): không tiểu được.
  9. PU (passed urine): đi tiểu).
  10. TUR (transurethral prostate resection): cắt tuyến tiền lập qua niệu đạo.
  11. URS (urogenital system): hệ tiết niệu-sinh dục.
  12. VD (venereal disease): bệnh hoa liễu.
  13. VE (vaginal examination): khám âm đạo.

Các thuật ngữ về hệ sinh sản nữ và sản khoa (thời kỳ thai nghén và sinh đẻ):

Abortion: sự xẩy thai Induced abortion: sự phá thai

Abruptio placentae: bong nhau/rau sớm

Afterbirth/placenta: nhau thai/rau thai Apgar scoring: thang điểm Apgar Ballotment: hiện tượng bập bềnh

Bag of water (BOW): màng ối Breech: mông/mông đít

Breech presentation: ngôi mông (sinh không bình thường) C(a)esarean: sinh mổ

C(a)esarean section/birth: sinh mổ Caul: màng thai

Climacteric/menopause: thời kỳ mãn kinh, tắt kinh Clitoris: âm vật

Change of life: thời kỳ mãn kinh, tắt kinh Conization: th/th cắt bỏ nón mô

Crowning: giai đoạn thai nhi lấp ló ở âm đạo Curettage: nạo

Delivery: sự sinh đẻ/chuyển dạ Abdominal delivery: mổ lấy thai/sinh mổ Difficult delivery/dystocia: sinh khó Easy delivery: sinh dễ

Estimated date of confinement (EDC): ngày dự sinh/ngày sinh dự đoán Expected date of delivery (EDD): ngày dự sinh/ngày sinh dự đoán Expected due date (EDD): ngày dự sinh/ngày sinh dự đoán

Forcepts delivery: lấy thai bằng sử dụng cặp thai Spontaneous delivery: sinh thường/đẻ tự nhiên Vaginal delivery: đẻ qua âm đạo

Vacuum assisted delivery: sinh hút Ectopic: sai vị trí

Ectopic pregnancy: thai lạc chỗ

Embryo: phôi

Engorgement: sự sung huyết Estrogen: estrogen

Foetus: thai, bào thai

Full-term birth: sự đẻ đủ tháng Gestation: ốm nghén

Hymen: màng trinh Infertility: vô sinh Insemination: sự thụ tinh

Artificial insemination: thụ tinh nhân tạo In vitro insemination: thụ tinh nhân tạo Introitus: đường vào/lỗ

Labo(u)r: sự chuyển dạ/đẻ Labo(u)r pains: đau đẻ

Complicated labo(u)r: đẻ biến chứng False labo(u)r: đẻ giả

Induced labo(u)r: đẻ có sự can thiệp Premature labo(u)r: đẻ non

Prolonged labo(u)r: sự chuyển dạ kéo dài Spontaneous labo(u)r: sinh thường/đẻ tự nhiên Parturition/childbirth: sự sinh đẻ

Lightening: sự sa bụng (sắp đẻ) Mammary papilla: núm vú Menarche: lần hành kinh đầu Menstruation/period: kinh nguyệt Miscarriage: sự sẩy thai

Morning sickness: ốm nghén Premature: sớm, non

Premature labor: đẻ non Presentation: ngôi/ngôi thai

Presentation and lie: ngôi thai và vị trí Prolapsed cord: sa dây rốn Quickening: thai đạp lần đầu Stillbirth: sự sinh ra một bào thai tử Trimester: ba tháng đầu của thai kỳ

Second trimester: ba tháng giữa của thai kỳ Third trimester: ba tháng cuối của thai kỳ Umbilical/navel cord: dây rốn

Version: thủ thuật xoay thai Cephalic version: xoay đầu

Vaginal birth after C(a)esarean: sinh thường sau khi đã từng sinh mổ Zygote: hợp tử, trứng được thụ tinh

Các thuật ngữ về sinh đẻ có kế hoạch:

Coitus interruptus: giao hợp gián đoạn/sự phóng tinh ra ngoài Condom/French letter/rubber: bao cao su

Contraception: sự tránh thai Contraceptives: thuốc và dụng cụ tránh thai Copper coil/hoop: vòng xoắn

Diaphragm: mủ tử cung

Morning-after pill: thuốc ngừa thai Intrauterine device (IUD): vòng tránh thai Oral contraceptive pill/Pill: thuốc ngừa thai Sterilization: sự triệt sản


Bạn cũng có thể truy cập website bằng tên miền https://capnhatykhoa.net